About ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate
ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate (PubChem CID 177307249) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate |
| PubChem CID | 177307249 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate |
| SMILES | CCOC(=O)C(C#N)=CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H13NO4/c1-2-18-13(17)10(8-14)5-3-9-4-6-11(15)12(16)7-9/h4-7,15-16H,2-3H2,1H3 |
| InChIKey | RVBHFLRFWMNOPT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate?
The IUPAC name of ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate (CID 177307249) is ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate.
What is the SMILES notation for ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate?
The canonical SMILES for ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate is CCOC(=O)C(C#N)=CCc1ccc(O)c(O)c1.
What is the InChIKey of ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate?
The InChIKey is RVBHFLRFWMNOPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c1-2-18-13(17)10(8-14)5-3-9-4-6-11(15)12(16)7-9/h4-7,15-16H,2-3H2,1H3.
What are the key properties of ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate?
ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate has a molecular weight of 247.25 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate is sourced from PubChem (CID 177307249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).