C13H13NO4 — CID 177307249
ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate (PubChem CID 177307249) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate.
| Compound Name | ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 177307249 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl 2-cyano-4-(3,4-dihydroxyphenyl)but-2-enoate |
| SMILES | CCOC(=O)C(C#N)=CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H13NO4/c1-2-18-13(17)10(8-14)5-3-9-4-6-11(15)12(16)7-9/h4-7,15-16H,2-3H2,1H3 |
| InChIKey | RVBHFLRFWMNOPT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|