C11H13NO3 — CID 66659236
(E)-4-(3,4-dihydroxyphenyl)-2-methylbut-2-enamide (PubChem CID 66659236) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (E)-4-(3,4-dihydroxyphenyl)-2-methylbut-2-enamide.
| Compound Name | (E)-4-(3,4-dihydroxyphenyl)-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 66659236 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (E)-4-(3,4-dihydroxyphenyl)-2-methylbut-2-enamide |
| SMILES | C/C(=C\Cc1ccc(O)c(O)c1)C(N)=O |
| InChI | InChI=1S/C11H13NO3/c1-7(11(12)15)2-3-8-4-5-9(13)10(14)6-8/h2,4-6,13-14H,3H2,1H3,(H2,12,15)/b7-2+ |
| InChIKey | WOTISYWEABDBPO-FARCUNLSSA-N |
| XLogP | 1.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|