C22H26N2O3 — CID 89471645
(E)-N-cyclohexyl-4-(3,4-dihydroxyphenyl)-2-methyl-N-pyridin-2-ylbut-2-enamide (PubChem CID 89471645) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (E)-N-cyclohexyl-4-(3,4-dihydroxyphenyl)-2-methyl-N-pyridin-2-ylbut-2-enamide.
| Compound Name | (E)-N-cyclohexyl-4-(3,4-dihydroxyphenyl)-2-methyl-N-pyridin-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 89471645 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (E)-N-cyclohexyl-4-(3,4-dihydroxyphenyl)-2-methyl-N-pyridin-2-ylbut-2-enamide |
| SMILES | C/C(=C\Cc1ccc(O)c(O)c1)C(=O)N(c1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C22H26N2O3/c1-16(10-11-17-12-13-19(25)20(26)15-17)22(27)24(18-7-3-2-4-8-18)21-9-5-6-14-23-21/h5-6,9-10,12-15,18,25-26H,2-4,7-8,11H2,1H3/b16-10+ |
| InChIKey | LVQUOHSFNGDGTJ-MHWRWJLKSA-N |
| XLogP | 4.35 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|