C22H24N2O3 — CID 123580869
4-(1,3-benzodioxol-5-yl)-N-cyclohexyl-N-pyridin-2-ylbut-3-enamide (PubChem CID 123580869) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-cyclohexyl-N-pyridin-2-ylbut-3-enamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-cyclohexyl-N-pyridin-2-ylbut-3-enamide |
|---|---|
| PubChem CID | 123580869 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-cyclohexyl-N-pyridin-2-ylbut-3-enamide |
| SMILES | O=C(CC=Cc1ccc2c(c1)OCO2)N(c1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C22H24N2O3/c25-22(11-6-7-17-12-13-19-20(15-17)27-16-26-19)24(18-8-2-1-3-9-18)21-10-4-5-14-23-21/h4-7,10,12-15,18H,1-3,8-9,11,16H2 |
| InChIKey | DLQVMAIXBLXWBD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |