C18H18N2O3S — CID 175764120
3-(1,3-benzodioxol-5-yl)-N-(2-methylsulfanylethyl)-N-pyridin-2-ylprop-2-enamide (PubChem CID 175764120) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(2-methylsulfanylethyl)-N-pyridin-2-ylprop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(2-methylsulfanylethyl)-N-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 175764120 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(2-methylsulfanylethyl)-N-pyridin-2-ylprop-2-enamide |
| SMILES | CSCCN(C(=O)C=Cc1ccc2c(c1)OCO2)c1ccccn1 |
| InChI | InChI=1S/C18H18N2O3S/c1-24-11-10-20(17-4-2-3-9-19-17)18(21)8-6-14-5-7-15-16(12-14)23-13-22-15/h2-9,12H,10-11,13H2,1H3 |
| InChIKey | BEUPCKWHSDVNLD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|