C22H24N2O3 — CID 89471460
N-cyclohexyl-2-(3,4-dihydroxyphenyl)-N-pyridin-2-ylpent-3-ynamide (PubChem CID 89471460) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4-dihydroxyphenyl)-N-pyridin-2-ylpent-3-ynamide.
| Compound Name | N-cyclohexyl-2-(3,4-dihydroxyphenyl)-N-pyridin-2-ylpent-3-ynamide |
|---|---|
| PubChem CID | 89471460 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-cyclohexyl-2-(3,4-dihydroxyphenyl)-N-pyridin-2-ylpent-3-ynamide |
| SMILES | CC#CC(C(=O)N(c1ccccn1)C1CCCCC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-2-8-18(16-12-13-19(25)20(26)15-16)22(27)24(17-9-4-3-5-10-17)21-11-6-7-14-23-21/h6-7,11-15,17-18,25-26H,3-5,9-10H2,1H3 |
| InChIKey | UVTAZYSJNCNMEA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|