C21H26N2O3 — CID 89471652
N-cyclohexyl-4-(3,4-dihydroxyphenyl)-N-pyridin-2-ylbutanamide (PubChem CID 89471652) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-cyclohexyl-4-(3,4-dihydroxyphenyl)-N-pyridin-2-ylbutanamide.
| Compound Name | N-cyclohexyl-4-(3,4-dihydroxyphenyl)-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 89471652 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-cyclohexyl-4-(3,4-dihydroxyphenyl)-N-pyridin-2-ylbutanamide |
| SMILES | O=C(CCCc1ccc(O)c(O)c1)N(c1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C21H26N2O3/c24-18-13-12-16(15-19(18)25)7-6-11-21(26)23(17-8-2-1-3-9-17)20-10-4-5-14-22-20/h4-5,10,12-15,17,24-25H,1-3,6-9,11H2 |
| InChIKey | VZXQOVGABQPLMI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|