About 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine
2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine (PubChem CID 58854562) has the molecular formula C9H12N4O2
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine |
| PubChem CID | 58854562 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine |
| SMILES | NC(N)=NN=CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H12N4O2/c10-9(11)13-12-4-3-6-1-2-7(14)8(15)5-6/h1-2,4-5,14-15H,3H2,(H4,10,11,13) |
| InChIKey | FJKFFOZYPKZUBV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine?
The IUPAC name of 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine (CID 58854562) is 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine.
What is the SMILES notation for 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine?
The canonical SMILES for 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine is NC(N)=NN=CCc1ccc(O)c(O)c1.
What is the InChIKey of 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine?
The InChIKey is FJKFFOZYPKZUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2/c10-9(11)13-12-4-3-6-1-2-7(14)8(15)5-6/h1-2,4-5,14-15H,3H2,(H4,10,11,13).
What are the key properties of 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine?
2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine has a molecular weight of 208.22 g/mol, XLogP of -0.10, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dihydroxyphenyl)ethylideneamino]guanidine is sourced from PubChem (CID 58854562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).