C9H8O3 — CID 54070329
3-(3,4-dihydroxyphenyl)prop-1-en-1-one (PubChem CID 54070329) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)prop-1-en-1-one.
| Compound Name | 3-(3,4-dihydroxyphenyl)prop-1-en-1-one |
|---|---|
| PubChem CID | 54070329 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)prop-1-en-1-one |
| SMILES | O=C=CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H8O3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1,3-4,6,11-12H,2H2 |
| InChIKey | UZANCIBZWJAEBP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|