C7H7NO3 — CID 54043215
4-(nitrosomethyl)benzene-1,2-diol (PubChem CID 54043215) has the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. Its IUPAC name is 4-(nitrosomethyl)benzene-1,2-diol.
| Compound Name | 4-(nitrosomethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 54043215 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 4-(nitrosomethyl)benzene-1,2-diol |
| SMILES | O=NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H7NO3/c9-6-2-1-5(4-8-11)3-7(6)10/h1-3,9-10H,4H2 |
| InChIKey | LNUGNUIYRSGUJT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|