About 4-(nitrosomethyl)phenol
4-(nitrosomethyl)phenol (PubChem CID 54346225) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 4-(nitrosomethyl)phenol.
Molecular Properties
| Compound Name | 4-(nitrosomethyl)phenol |
| PubChem CID | 54346225 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 4-(nitrosomethyl)phenol |
| SMILES | O=NCc1ccc(O)cc1 |
| InChI | InChI=1S/C7H7NO2/c9-7-3-1-6(2-4-7)5-8-10/h1-4,9H,5H2 |
| InChIKey | UCMJYLGFDFZTDU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(nitrosomethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(nitrosomethyl)phenol?
The IUPAC name of 4-(nitrosomethyl)phenol (CID 54346225) is 4-(nitrosomethyl)phenol.
What is the SMILES notation for 4-(nitrosomethyl)phenol?
The canonical SMILES for 4-(nitrosomethyl)phenol is O=NCc1ccc(O)cc1.
What is the InChIKey of 4-(nitrosomethyl)phenol?
The InChIKey is UCMJYLGFDFZTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-7-3-1-6(2-4-7)5-8-10/h1-4,9H,5H2.
What are the key properties of 4-(nitrosomethyl)phenol?
4-(nitrosomethyl)phenol has a molecular weight of 137.14 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(nitrosomethyl)phenol is sourced from PubChem (CID 54346225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).