About ethane;4-ethylphenol;formaldehyde
ethane;4-ethylphenol;formaldehyde (PubChem CID 131698499) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is ethane;4-ethylphenol;formaldehyde.
Molecular Properties
| Compound Name | ethane;4-ethylphenol;formaldehyde |
| PubChem CID | 131698499 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethane;4-ethylphenol;formaldehyde |
| SMILES | C=O.CC.CC.CCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H10O.2C2H6.CH2O/c1-2-7-3-5-8(9)6-4-7;3*1-2/h3-6,9H,2H2,1H3;2*1-2H3;1H2 |
| InChIKey | HKZPORJFBLCTJG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethylphenol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethylphenol;formaldehyde?
The IUPAC name of ethane;4-ethylphenol;formaldehyde (CID 131698499) is ethane;4-ethylphenol;formaldehyde.
What is the SMILES notation for ethane;4-ethylphenol;formaldehyde?
The canonical SMILES for ethane;4-ethylphenol;formaldehyde is C=O.CC.CC.CCc1ccc(O)cc1.
What is the InChIKey of ethane;4-ethylphenol;formaldehyde?
The InChIKey is HKZPORJFBLCTJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.2C2H6.CH2O/c1-2-7-3-5-8(9)6-4-7;3*1-2/h3-6,9H,2H2,1H3;2*1-2H3;1H2.
What are the key properties of ethane;4-ethylphenol;formaldehyde?
ethane;4-ethylphenol;formaldehyde has a molecular weight of 212.33 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethylphenol;formaldehyde is sourced from PubChem (CID 131698499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).