C7H7NaO5S — CID 23706992
sodium (3,4-dihydroxyphenyl)methanesulfonate (PubChem CID 23706992) has the molecular formula C7H7NaO5S and a molecular weight of 226.18 g/mol. Its IUPAC name is sodium (3,4-dihydroxyphenyl)methanesulfonate.
| Compound Name | sodium (3,4-dihydroxyphenyl)methanesulfonate |
|---|---|
| PubChem CID | 23706992 |
| Molecular Formula | C7H7NaO5S |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | sodium (3,4-dihydroxyphenyl)methanesulfonate |
| SMILES | O=S(=O)([O-])Cc1ccc(O)c(O)c1.[Na+] |
| InChI | InChI=1S/C7H8O5S.Na/c8-6-2-1-5(3-7(6)9)4-13(10,11)12;/h1-3,8-9H,4H2,(H,10,11,12);/q;+1/p-1 |
| InChIKey | XHVRREMDLKPBGM-UHFFFAOYSA-M |
| XLogP | -2.85 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|