About 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid
4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid (PubChem CID 150524950) has the molecular formula C16H18O5S
and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid.
Molecular Properties
| Compound Name | 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid |
| PubChem CID | 150524950 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid |
| SMILES | C[C@H](Cc1ccc(S(=O)(=O)O)cc1)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H18O5S/c1-11(9-13-4-7-15(17)16(18)10-13)8-12-2-5-14(6-3-12)22(19,20)21/h2-7,10-11,17-18H,8-9H2,1H3,(H,19,20,21)/t11-/m1/s1 |
| InChIKey | ICPNAAWDGKGAED-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid?
The IUPAC name of 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid (CID 150524950) is 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid.
What is the SMILES notation for 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid?
The canonical SMILES for 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid is C[C@H](Cc1ccc(S(=O)(=O)O)cc1)Cc1ccc(O)c(O)c1.
What is the InChIKey of 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid?
The InChIKey is ICPNAAWDGKGAED-LLVKDONJSA-N. The full InChI is InChI=1S/C16H18O5S/c1-11(9-13-4-7-15(17)16(18)10-13)8-12-2-5-14(6-3-12)22(19,20)21/h2-7,10-11,17-18H,8-9H2,1H3,(H,19,20,21)/t11-/m1/s1.
What are the key properties of 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid?
4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid has a molecular weight of 322.38 g/mol, XLogP of 2.77, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-3-(3,4-dihydroxyphenyl)-2-methylpropyl]benzenesulfonic acid is sourced from PubChem (CID 150524950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).