C10H14O5S — CID 22860328
[(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl] methanesulfonate (PubChem CID 22860328) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is [(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 22860328 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl] methanesulfonate |
| SMILES | C[C@H](Cc1ccc(O)c(O)c1)OS(C)(=O)=O |
| InChI | InChI=1S/C10H14O5S/c1-7(15-16(2,13)14)5-8-3-4-9(11)10(12)6-8/h3-4,6-7,11-12H,5H2,1-2H3/t7-/m1/s1 |
| InChIKey | LVPKMQGBSFLBOE-SSDOTTSWSA-N |
| XLogP | 1.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|