C12H18O5S — CID 21192341
1-(3,4-dimethoxyphenyl)propan-2-yl methanesulfonate (PubChem CID 21192341) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)propan-2-yl methanesulfonate.
| Compound Name | 1-(3,4-dimethoxyphenyl)propan-2-yl methanesulfonate |
|---|---|
| PubChem CID | 21192341 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)propan-2-yl methanesulfonate |
| SMILES | COc1ccc(CC(C)OS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C12H18O5S/c1-9(17-18(4,13)14)7-10-5-6-11(15-2)12(8-10)16-3/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | PIXOCIHHRAKQLF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|