C19H24O4S — CID 172839423
4-[2-methyl-3-(2-propan-2-ylphenoxy)propyl]benzenesulfonic acid (PubChem CID 172839423) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is 4-[2-methyl-3-(2-propan-2-ylphenoxy)propyl]benzenesulfonic acid.
| Compound Name | 4-[2-methyl-3-(2-propan-2-ylphenoxy)propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 172839423 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[2-methyl-3-(2-propan-2-ylphenoxy)propyl]benzenesulfonic acid |
| SMILES | CC(COc1ccccc1C(C)C)Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H24O4S/c1-14(2)18-6-4-5-7-19(18)23-13-15(3)12-16-8-10-17(11-9-16)24(20,21)22/h4-11,14-15H,12-13H2,1-3H3,(H,20,21,22) |
| InChIKey | WPCGZPFUGGDTLY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|