C10H14N4 — CID 5053229
2-(3-phenylpropylideneamino)guanidine (PubChem CID 5053229) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(3-phenylpropylideneamino)guanidine.
| Compound Name | 2-(3-phenylpropylideneamino)guanidine |
|---|---|
| PubChem CID | 5053229 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-(3-phenylpropylideneamino)guanidine |
| SMILES | NC(N)=NN=CCCc1ccccc1 |
| InChI | InChI=1S/C10H14N4/c11-10(12)14-13-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,8H,4,7H2,(H4,11,12,14) |
| InChIKey | FLUHNUBJGRDBLZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|