C22H24ClN5 — CID 69343804
2-[3-[1-(4-chlorophenyl)-5-(2-phenylethyl)pyrrol-3-yl]propylideneamino]guanidine (PubChem CID 69343804) has the molecular formula C22H24ClN5 and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-[3-[1-(4-chlorophenyl)-5-(2-phenylethyl)pyrrol-3-yl]propylideneamino]guanidine.
| Compound Name | 2-[3-[1-(4-chlorophenyl)-5-(2-phenylethyl)pyrrol-3-yl]propylideneamino]guanidine |
|---|---|
| PubChem CID | 69343804 |
| Molecular Formula | C22H24ClN5 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[3-[1-(4-chlorophenyl)-5-(2-phenylethyl)pyrrol-3-yl]propylideneamino]guanidine |
| SMILES | NC(N)=NN=CCCc1cc(CCc2ccccc2)n(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H24ClN5/c23-19-9-12-20(13-10-19)28-16-18(7-4-14-26-27-22(24)25)15-21(28)11-8-17-5-2-1-3-6-17/h1-3,5-6,9-10,12-16H,4,7-8,11H2,(H4,24,25,27) |
| InChIKey | XKEKCURPQOKKLI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|