C10H13N3S — CID 158206951
methyl N'-(2-phenylethylideneamino)carbamimidothioate (PubChem CID 158206951) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is methyl N'-(2-phenylethylideneamino)carbamimidothioate.
| Compound Name | methyl N'-(2-phenylethylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 158206951 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | methyl N'-(2-phenylethylideneamino)carbamimidothioate |
| SMILES | CSC(N)=NN=CCc1ccccc1 |
| InChI | InChI=1S/C10H13N3S/c1-14-10(11)13-12-8-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,13) |
| InChIKey | WISFQYZUOHFEFR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|