C12H17N3S — CID 131862850
methyl N'-(1-phenylbutylideneamino)carbamimidothioate (PubChem CID 131862850) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is methyl N'-(1-phenylbutylideneamino)carbamimidothioate.
| Compound Name | methyl N'-(1-phenylbutylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 131862850 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | methyl N'-(1-phenylbutylideneamino)carbamimidothioate |
| SMILES | CCCC(=N/N=C(\N)SC)c1ccccc1 |
| InChI | InChI=1S/C12H17N3S/c1-3-7-11(14-15-12(13)16-2)10-8-5-4-6-9-10/h4-6,8-9H,3,7H2,1-2H3,(H2,13,15) |
| InChIKey | CJJPSEYJKHSKCF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|