C9H23NO4P+ — CID 163641809
2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 163641809) has the molecular formula C9H23NO4P+ and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 163641809 |
| Molecular Formula | C9H23NO4P+ |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCOP(=O)(OC)OCC[N+](C)(C)C |
| InChI | InChI=1S/C9H23NO4P/c1-6-8-13-15(11,12-5)14-9-7-10(2,3)4/h6-9H2,1-5H3/q+1 |
| InChIKey | IEWKTTOYBYRVDW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|