C11H29NO4P+ — CID 176693760
ethane;2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 176693760) has the molecular formula C11H29NO4P+ and a molecular weight of 270.33 g/mol. Its IUPAC name is ethane;2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | ethane;2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 176693760 |
| Molecular Formula | C11H29NO4P+ |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | ethane;2-[methoxy(propoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC.CCCOP(=O)(OC)OCC[N+](C)(C)C |
| InChI | InChI=1S/C9H23NO4P.C2H6/c1-6-8-13-15(11,12-5)14-9-7-10(2,3)4;1-2/h6-9H2,1-5H3;1-2H3/q+1; |
| InChIKey | KUBGKOWVBHQVSK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|