C12H25NO8P+ — CID 59476545
2-[2-(2-acetyloxypropanoyloxy)ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59476545) has the molecular formula C12H25NO8P+ and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-[2-(2-acetyloxypropanoyloxy)ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-(2-acetyloxypropanoyloxy)ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59476545 |
| Molecular Formula | C12H25NO8P+ |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[2-(2-acetyloxypropanoyloxy)ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(=O)OC(C)C(=O)OCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C12H24NO8P/c1-10(21-11(2)14)12(15)18-8-9-20-22(16,17)19-7-6-13(3,4)5/h10H,6-9H2,1-5H3/p+1 |
| InChIKey | RGNAKPUHSSEDQN-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|