C12H26NO8P — CID 88516849
2-(2-acetyloxypropanoyloxy)ethyl-trimethylazanium;dimethyl phosphate (PubChem CID 88516849) has the molecular formula C12H26NO8P and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-(2-acetyloxypropanoyloxy)ethyl-trimethylazanium;dimethyl phosphate.
| Compound Name | 2-(2-acetyloxypropanoyloxy)ethyl-trimethylazanium;dimethyl phosphate |
|---|---|
| PubChem CID | 88516849 |
| Molecular Formula | C12H26NO8P |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-(2-acetyloxypropanoyloxy)ethyl-trimethylazanium;dimethyl phosphate |
| SMILES | CC(=O)OC(C)C(=O)OCC[N+](C)(C)C.COP(=O)([O-])OC |
| InChI | InChI=1S/C10H20NO4.C2H7O4P/c1-8(15-9(2)12)10(13)14-7-6-11(3,4)5;1-5-7(3,4)6-2/h8H,6-7H2,1-5H3;1-2H3,(H,3,4)/q+1;/p-1 |
| InChIKey | VSYKRAFSFUPBMR-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|