C13H27N2O3+ — CID 58805543
(5-amino-2-ethyl-2,4-dimethyl-5-oxopentanoyl)oxymethyl-trimethylazanium (PubChem CID 58805543) has the molecular formula C13H27N2O3+ and a molecular weight of 259.37 g/mol. Its IUPAC name is (5-amino-2-ethyl-2,4-dimethyl-5-oxopentanoyl)oxymethyl-trimethylazanium.
| Compound Name | (5-amino-2-ethyl-2,4-dimethyl-5-oxopentanoyl)oxymethyl-trimethylazanium |
|---|---|
| PubChem CID | 58805543 |
| Molecular Formula | C13H27N2O3+ |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (5-amino-2-ethyl-2,4-dimethyl-5-oxopentanoyl)oxymethyl-trimethylazanium |
| SMILES | CCC(C)(CC(C)C(N)=O)C(=O)OC[N+](C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-7-13(3,8-10(2)11(14)16)12(17)18-9-15(4,5)6/h10H,7-9H2,1-6H3,(H-,14,16)/p+1 |
| InChIKey | WDPPEHPEZIZSHS-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|