C19H35NO7 — CID 22085921
1-O-(1-hydroxypropan-2-yl) 5-O-(2-methoxyethyl) 4-(3-amino-2-methyl-3-oxopropyl)-2-ethyl-2,4-dimethylpentanedioate (PubChem CID 22085921) has the molecular formula C19H35NO7 and a molecular weight of 389.49 g/mol. Its IUPAC name is 1-O-(1-hydroxypropan-2-yl) 5-O-(2-methoxyethyl) 4-(3-amino-2-methyl-3-oxopropyl)-2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 1-O-(1-hydroxypropan-2-yl) 5-O-(2-methoxyethyl) 4-(3-amino-2-methyl-3-oxopropyl)-2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 22085921 |
| Molecular Formula | C19H35NO7 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 1-O-(1-hydroxypropan-2-yl) 5-O-(2-methoxyethyl) 4-(3-amino-2-methyl-3-oxopropyl)-2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(CC(C)C(N)=O)C(=O)OCCOC)C(=O)OC(C)CO |
| InChI | InChI=1S/C19H35NO7/c1-7-18(4,17(24)27-14(3)11-21)12-19(5,10-13(2)15(20)22)16(23)26-9-8-25-6/h13-14,21H,7-12H2,1-6H3,(H2,20,22) |
| InChIKey | KWSYSJALHKAMKV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|