C26H49FeNO4 — CID 162288982
cyclopentane;iron;2-methoxyethyl 4-cyclopentyl-7-(dimethylamino)-2-ethyl-2,6-dimethyl-7-oxoheptanoate (PubChem CID 162288982) has the molecular formula C26H49FeNO4 and a molecular weight of 495.53 g/mol. Its IUPAC name is cyclopentane;iron;2-methoxyethyl 4-cyclopentyl-7-(dimethylamino)-2-ethyl-2,6-dimethyl-7-oxoheptanoate.
| Compound Name | cyclopentane;iron;2-methoxyethyl 4-cyclopentyl-7-(dimethylamino)-2-ethyl-2,6-dimethyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 162288982 |
| Molecular Formula | C26H49FeNO4 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | cyclopentane;iron;2-methoxyethyl 4-cyclopentyl-7-(dimethylamino)-2-ethyl-2,6-dimethyl-7-oxoheptanoate |
| SMILES | C1CCCC1.CCC(C)(CC(CC(C)C(=O)N(C)C)C1CCCC1)C(=O)OCCOC.[Fe] |
| InChI | InChI=1S/C21H39NO4.C5H10.Fe/c1-7-21(3,20(24)26-13-12-25-6)15-18(17-10-8-9-11-17)14-16(2)19(23)22(4)5;1-2-4-5-3-1;/h16-18H,7-15H2,1-6H3;1-5H2; |
| InChIKey | BOABXVAVYGHCFR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|