C31H57N5O5 — CID 154591655
5-cyclopentyl-3-N-[[[5-(dimethylamino)-2,4-dimethyl-5-oxopentanoyl]amino]methyl]-1-N,1-N,7-N,7-N,1-pentamethyloctane-1,3,7-tricarboxamide (PubChem CID 154591655) has the molecular formula C31H57N5O5 and a molecular weight of 579.83 g/mol. Its IUPAC name is 5-cyclopentyl-3-N-[[[5-(dimethylamino)-2,4-dimethyl-5-oxopentanoyl]amino]methyl]-1-N,1-N,7-N,7-N,1-pentamethyloctane-1,3,7-tricarboxamide.
| Compound Name | 5-cyclopentyl-3-N-[[[5-(dimethylamino)-2,4-dimethyl-5-oxopentanoyl]amino]methyl]-1-N,1-N,7-N,7-N,1-pentamethyloctane-1,3,7-tricarboxamide |
|---|---|
| PubChem CID | 154591655 |
| Molecular Formula | C31H57N5O5 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.44 |
| IUPAC Name | 5-cyclopentyl-3-N-[[[5-(dimethylamino)-2,4-dimethyl-5-oxopentanoyl]amino]methyl]-1-N,1-N,7-N,7-N,1-pentamethyloctane-1,3,7-tricarboxamide |
| SMILES | CC(CC(C)C(=O)N(C)C)C(=O)NCNC(=O)C(CC(C)C(=O)N(C)C)CC(CC(C)C(=O)N(C)C)C1CCCC1 |
| InChI | InChI=1S/C31H57N5O5/c1-20(15-21(2)29(39)34(5)6)27(37)32-19-33-28(38)26(17-23(4)31(41)36(9)10)18-25(24-13-11-12-14-24)16-22(3)30(40)35(7)8/h20-26H,11-19H2,1-10H3,(H,32,37)(H,33,38) |
| InChIKey | COPXFVURLCRIIN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|