C18H21F5O5 — CID 118260614
1-O-(2-methoxyethyl) 5-O-(2,3,4,5,6-pentafluorophenyl) 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 118260614) has the molecular formula C18H21F5O5 and a molecular weight of 412.35 g/mol. Its IUPAC name is 1-O-(2-methoxyethyl) 5-O-(2,3,4,5,6-pentafluorophenyl) 2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 1-O-(2-methoxyethyl) 5-O-(2,3,4,5,6-pentafluorophenyl) 2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 118260614 |
| Molecular Formula | C18H21F5O5 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-O-(2-methoxyethyl) 5-O-(2,3,4,5,6-pentafluorophenyl) 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)OCCOC |
| InChI | InChI=1S/C18H21F5O5/c1-5-18(3,17(25)27-7-6-26-4)8-9(2)16(24)28-15-13(22)11(20)10(19)12(21)14(15)23/h9H,5-8H2,1-4H3 |
| InChIKey | IWCLGDZZVWONQJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|