C11H10F5NO2 — CID 88576361
(2,3,4,5,6-pentafluorophenyl) 4-amino-2-methylbutanoate (PubChem CID 88576361) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-amino-2-methylbutanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-amino-2-methylbutanoate |
|---|---|
| PubChem CID | 88576361 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-amino-2-methylbutanoate |
| SMILES | CC(CCN)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5NO2/c1-4(2-3-17)11(18)19-10-8(15)6(13)5(12)7(14)9(10)16/h4H,2-3,17H2,1H3 |
| InChIKey | YCKLRSLUYVERRX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|