C12H22O3 — CID 144582731
1-oxopropan-2-yl 2-ethyl-2,4-dimethylpentanoate (PubChem CID 144582731) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1-oxopropan-2-yl 2-ethyl-2,4-dimethylpentanoate.
| Compound Name | 1-oxopropan-2-yl 2-ethyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 144582731 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1-oxopropan-2-yl 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)C)C(=O)OC(C)C=O |
| InChI | InChI=1S/C12H22O3/c1-6-12(5,7-9(2)3)11(14)15-10(4)8-13/h8-10H,6-7H2,1-5H3 |
| InChIKey | CQVCSGKRNATAHJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|