About [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate
[4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate (PubChem CID 123349001) has the molecular formula C19H39NO2
and a molecular weight of 313.53 g/mol. Its IUPAC name is [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate |
| PubChem CID | 123349001 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(CC)(CN)CC(C)(C)OC(=O)C(C)(CC)CC(C)C |
| InChI | InChI=1S/C19H39NO2/c1-9-18(8,12-15(4)5)16(21)22-17(6,7)13-19(10-2,11-3)14-20/h15H,9-14,20H2,1-8H3 |
| InChIKey | UPXLAVCTVPCUSE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
The IUPAC name of [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate (CID 123349001) is [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate.
What is the SMILES notation for [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
The canonical SMILES for [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate is CCC(CC)(CN)CC(C)(C)OC(=O)C(C)(CC)CC(C)C.
What is the InChIKey of [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
The InChIKey is UPXLAVCTVPCUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO2/c1-9-18(8,12-15(4)5)16(21)22-17(6,7)13-19(10-2,11-3)14-20/h15H,9-14,20H2,1-8H3.
What are the key properties of [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
[4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate has a molecular weight of 313.53 g/mol, XLogP of 4.93, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)-4-ethyl-2-methylhexan-2-yl] 2-ethyl-2,4-dimethylpentanoate is sourced from PubChem (CID 123349001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).