C20H38NO8+ — CID 72587609
2-[2-ethyl-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoyl]oxyethyl-[3-hydroxy-3-(2-hydroxyethoxy)prop-2-enyl]-dimethylazanium (PubChem CID 72587609) has the molecular formula C20H38NO8+ and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-[2-ethyl-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoyl]oxyethyl-[3-hydroxy-3-(2-hydroxyethoxy)prop-2-enyl]-dimethylazanium.
| Compound Name | 2-[2-ethyl-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoyl]oxyethyl-[3-hydroxy-3-(2-hydroxyethoxy)prop-2-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 72587609 |
| Molecular Formula | C20H38NO8+ |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 2-[2-ethyl-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoyl]oxyethyl-[3-hydroxy-3-(2-hydroxyethoxy)prop-2-enyl]-dimethylazanium |
| SMILES | CCC(C)(CC(C)C(=O)OCCO)C(=O)OCC[N+](C)(C)CC=C(O)OCCO |
| InChI | InChI=1S/C20H37NO8/c1-6-20(3,15-16(2)18(25)28-14-11-23)19(26)29-12-9-21(4,5)8-7-17(24)27-13-10-22/h7,16,22-23H,6,8-15H2,1-5H3/p+1 |
| InChIKey | FSFXKUDFZKZYGE-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|