C13H26NO4+ — CID 59753071
carboxymethyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium (PubChem CID 59753071) has the molecular formula C13H26NO4+ and a molecular weight of 260.35 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 59753071 |
| Molecular Formula | C13H26NO4+ |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | carboxymethyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium |
| SMILES | CC(C)C(C)(C)C(=O)OCC[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C13H25NO4/c1-10(2)13(3,4)12(17)18-8-7-14(5,6)9-11(15)16/h10H,7-9H2,1-6H3/p+1 |
| InChIKey | BEZQLRYAOZEQKW-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|