C11H20O5 — CID 88734161
6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid (PubChem CID 88734161) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid.
| Compound Name | 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 88734161 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid |
| SMILES | CC(CCC(=O)O)C(C)(C)C(=O)OCCO |
| InChI | InChI=1S/C11H20O5/c1-8(4-5-9(13)14)11(2,3)10(15)16-7-6-12/h8,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | MYQDNEUGFKDOMP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |