6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid

C11H20O5 — CID 88734161

IUPAC6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid
SMILESCC(CCC(=O)O)C(C)(C)C(=O)OCCO
InChIInChI=1S/C11H20O5/c1-8(4-5-9(13)14)11(2,3)10(15)16-7-6-12/h8,12H,4-7H2,1-3H3,(H,13,14)
InChIKeyMYQDNEUGFKDOMP-UHFFFAOYSA-N
MW232.28 g/mol
LogP1.05
Rot. Bonds7

About 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid

6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid (PubChem CID 88734161) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid.

Molecular Properties

Compound Name6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid
PubChem CID88734161
Molecular FormulaC11H20O5
Molecular Weight232.28 g/mol
Exact Mass232.13
IUPAC Name6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid
SMILESCC(CCC(=O)O)C(C)(C)C(=O)OCCO
InChIInChI=1S/C11H20O5/c1-8(4-5-9(13)14)11(2,3)10(15)16-7-6-12/h8,12H,4-7H2,1-3H3,(H,13,14)
InChIKeyMYQDNEUGFKDOMP-UHFFFAOYSA-N
XLogP1.05
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid?
The IUPAC name of 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid (CID 88734161) is 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid.
What is the SMILES notation for 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid?
The canonical SMILES for 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid is CC(CCC(=O)O)C(C)(C)C(=O)OCCO.
What is the InChIKey of 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid?
The InChIKey is MYQDNEUGFKDOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-8(4-5-9(13)14)11(2,3)10(15)16-7-6-12/h8,12H,4-7H2,1-3H3,(H,13,14).
What are the key properties of 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid?
6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid has a molecular weight of 232.28 g/mol, XLogP of 1.05, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-hydroxyethoxy)-4,5,5-trimethyl-6-oxohexanoic acid is sourced from PubChem (CID 88734161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).