C8H17NO6 — CID 87638899
2-aminopentanedioic acid;2-methoxyethanol (PubChem CID 87638899) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-aminopentanedioic acid;2-methoxyethanol.
| Compound Name | 2-aminopentanedioic acid;2-methoxyethanol |
|---|---|
| PubChem CID | 87638899 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-aminopentanedioic acid;2-methoxyethanol |
| SMILES | COCCO.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C3H8O2/c6-3(5(9)10)1-2-4(7)8;1-5-3-2-4/h3H,1-2,6H2,(H,7,8)(H,9,10);4H,2-3H2,1H3 |
| InChIKey | UWAHJXPJOQRARD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |