C9H17ClO4Si — CID 131727835
5-chlorosilyl-6-methoxy-4,5-dimethyl-6-oxohexanoic acid (PubChem CID 131727835) has the molecular formula C9H17ClO4Si and a molecular weight of 252.77 g/mol. Its IUPAC name is 5-chlorosilyl-6-methoxy-4,5-dimethyl-6-oxohexanoic acid.
| Compound Name | 5-chlorosilyl-6-methoxy-4,5-dimethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 131727835 |
| Molecular Formula | C9H17ClO4Si |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-chlorosilyl-6-methoxy-4,5-dimethyl-6-oxohexanoic acid |
| SMILES | COC(=O)C(C)([SiH2]Cl)C(C)CCC(=O)O |
| InChI | InChI=1S/C9H17ClO4Si/c1-6(4-5-7(11)12)9(2,15-10)8(13)14-3/h6H,4-5,15H2,1-3H3,(H,11,12) |
| InChIKey | NRBQKGIDUCTNMO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|