C10H20ClNO4 — CID 164588662
(4S)-4-(tert-butylamino)-5-methoxy-5-oxopentanoic acid;hydrochloride (PubChem CID 164588662) has the molecular formula C10H20ClNO4 and a molecular weight of 253.73 g/mol. Its IUPAC name is (4S)-4-(tert-butylamino)-5-methoxy-5-oxopentanoic acid;hydrochloride.
| Compound Name | (4S)-4-(tert-butylamino)-5-methoxy-5-oxopentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 164588662 |
| Molecular Formula | C10H20ClNO4 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (4S)-4-(tert-butylamino)-5-methoxy-5-oxopentanoic acid;hydrochloride |
| SMILES | COC(=O)[C@H](CCC(=O)O)NC(C)(C)C.Cl |
| InChI | InChI=1S/C10H19NO4.ClH/c1-10(2,3)11-7(9(14)15-4)5-6-8(12)13;/h7,11H,5-6H2,1-4H3,(H,12,13);1H/t7-;/m0./s1 |
| InChIKey | NCOQJALRKCHPIU-FJXQXJEOSA-N |
| XLogP | 1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |