C15H25NO7 — CID 162074248
(3S,6R)-6-(tert-butylamino)-5-oxooctane-1,3,8-tricarboxylic acid (PubChem CID 162074248) has the molecular formula C15H25NO7 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3S,6R)-6-(tert-butylamino)-5-oxooctane-1,3,8-tricarboxylic acid.
| Compound Name | (3S,6R)-6-(tert-butylamino)-5-oxooctane-1,3,8-tricarboxylic acid |
|---|---|
| PubChem CID | 162074248 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3S,6R)-6-(tert-butylamino)-5-oxooctane-1,3,8-tricarboxylic acid |
| SMILES | CC(C)(C)N[C@H](CCC(=O)O)C(=O)C[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25NO7/c1-15(2,3)16-10(5-7-13(20)21)11(17)8-9(14(22)23)4-6-12(18)19/h9-10,16H,4-8H2,1-3H3,(H,18,19)(H,20,21)(H,22,23)/t9-,10+/m0/s1 |
| InChIKey | ZBMNVZPNXSMAOE-VHSXEESVSA-N |
| XLogP | 1.13 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |