C21H39NO5 — CID 158441499
(2S,7R)-7-(tert-butylamino)-2-(6,6-dimethylheptyl)-4-oxooctanedioic acid (PubChem CID 158441499) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is (2S,7R)-7-(tert-butylamino)-2-(6,6-dimethylheptyl)-4-oxooctanedioic acid.
| Compound Name | (2S,7R)-7-(tert-butylamino)-2-(6,6-dimethylheptyl)-4-oxooctanedioic acid |
|---|---|
| PubChem CID | 158441499 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (2S,7R)-7-(tert-butylamino)-2-(6,6-dimethylheptyl)-4-oxooctanedioic acid |
| SMILES | CC(C)(C)CCCCC[C@@H](CC(=O)CC[C@@H](NC(C)(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H39NO5/c1-20(2,3)13-9-7-8-10-15(18(24)25)14-16(23)11-12-17(19(26)27)22-21(4,5)6/h15,17,22H,7-14H2,1-6H3,(H,24,25)(H,26,27)/t15-,17+/m0/s1 |
| InChIKey | HCWHNTVAWGGFGY-DOTOQJQBSA-N |
| XLogP | 4.26 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|