C34H62O10 — CID 160534636
7-(4,4-dimethylpentoxy)-2,6-dimethyl-4,7-dioxoheptanoic acid;8-(4,4-dimethylpentoxy)-2,7-dimethyl-5,8-dioxooctanoic acid;methane (PubChem CID 160534636) has the molecular formula C34H62O10 and a molecular weight of 630.86 g/mol. Its IUPAC name is 7-(4,4-dimethylpentoxy)-2,6-dimethyl-4,7-dioxoheptanoic acid;8-(4,4-dimethylpentoxy)-2,7-dimethyl-5,8-dioxooctanoic acid;methane.
| Compound Name | 7-(4,4-dimethylpentoxy)-2,6-dimethyl-4,7-dioxoheptanoic acid;8-(4,4-dimethylpentoxy)-2,7-dimethyl-5,8-dioxooctanoic acid;methane |
|---|---|
| PubChem CID | 160534636 |
| Molecular Formula | C34H62O10 |
| Molecular Weight | 630.86 g/mol |
| Exact Mass | 630.43 |
| IUPAC Name | 7-(4,4-dimethylpentoxy)-2,6-dimethyl-4,7-dioxoheptanoic acid;8-(4,4-dimethylpentoxy)-2,7-dimethyl-5,8-dioxooctanoic acid;methane |
| SMILES | C.CC(CC(=O)CC(C)C(=O)OCCCC(C)(C)C)C(=O)O.CC(CCC(=O)CC(C)C(=O)OCCCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H30O5.C16H28O5.CH4/c1-12(15(19)20)7-8-14(18)11-13(2)16(21)22-10-6-9-17(3,4)5;1-11(14(18)19)9-13(17)10-12(2)15(20)21-8-6-7-16(3,4)5;/h12-13H,6-11H2,1-5H3,(H,19,20);11-12H,6-10H2,1-5H3,(H,18,19);1H4 |
| InChIKey | QVZKGXYMTFANHI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.86 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|