C8H11F3O3 — CID 153139701
(2R)-7,7,7-trifluoro-2-methyl-4-oxoheptanoic acid (PubChem CID 153139701) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is (2R)-7,7,7-trifluoro-2-methyl-4-oxoheptanoic acid.
| Compound Name | (2R)-7,7,7-trifluoro-2-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 153139701 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (2R)-7,7,7-trifluoro-2-methyl-4-oxoheptanoic acid |
| SMILES | C[C@H](CC(=O)CCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H11F3O3/c1-5(7(13)14)4-6(12)2-3-8(9,10)11/h5H,2-4H2,1H3,(H,13,14)/t5-/m1/s1 |
| InChIKey | VYJNXPNQDKZPAZ-RXMQYKEDSA-N |
| XLogP | 2.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |