C16H29NO5 — CID 158710731
2-amino-8-(4,4-dimethylpentoxy)-7-methyl-5,8-dioxooctanoic acid (PubChem CID 158710731) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-amino-8-(4,4-dimethylpentoxy)-7-methyl-5,8-dioxooctanoic acid.
| Compound Name | 2-amino-8-(4,4-dimethylpentoxy)-7-methyl-5,8-dioxooctanoic acid |
|---|---|
| PubChem CID | 158710731 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-amino-8-(4,4-dimethylpentoxy)-7-methyl-5,8-dioxooctanoic acid |
| SMILES | CC(CC(=O)CCC(N)C(=O)O)C(=O)OCCCC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-11(10-12(18)6-7-13(17)14(19)20)15(21)22-9-5-8-16(2,3)4/h11,13H,5-10,17H2,1-4H3,(H,19,20) |
| InChIKey | VLNZBMYMWJFYKW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|