C25H41NO8 — CID 147169147
(2R)-11-[[(1S)-1-carboxy-5-methyl-4-oxohexyl]amino]-2-(4-methyl-3-oxopentyl)-4,11-dioxoundecanoic acid (PubChem CID 147169147) has the molecular formula C25H41NO8 and a molecular weight of 483.60 g/mol. Its IUPAC name is (2R)-11-[[(1S)-1-carboxy-5-methyl-4-oxohexyl]amino]-2-(4-methyl-3-oxopentyl)-4,11-dioxoundecanoic acid.
| Compound Name | (2R)-11-[[(1S)-1-carboxy-5-methyl-4-oxohexyl]amino]-2-(4-methyl-3-oxopentyl)-4,11-dioxoundecanoic acid |
|---|---|
| PubChem CID | 147169147 |
| Molecular Formula | C25H41NO8 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2R)-11-[[(1S)-1-carboxy-5-methyl-4-oxohexyl]amino]-2-(4-methyl-3-oxopentyl)-4,11-dioxoundecanoic acid |
| SMILES | CC(C)C(=O)CC[C@H](CC(=O)CCCCCCC(=O)N[C@@H](CCC(=O)C(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H41NO8/c1-16(2)21(28)13-11-18(24(31)32)15-19(27)9-7-5-6-8-10-23(30)26-20(25(33)34)12-14-22(29)17(3)4/h16-18,20H,5-15H2,1-4H3,(H,26,30)(H,31,32)(H,33,34)/t18-,20+/m1/s1 |
| InChIKey | BXJPPFVXUKCLPZ-QUCCMNQESA-N |
| XLogP | 3.57 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|