C23H38N2O8 — CID 137425847
(2S)-2-[[8-[[(1S)-1-carboxy-4-oxohexyl]amino]-8-oxooctanoyl]amino]-6-methyl-5-oxoheptanoic acid (PubChem CID 137425847) has the molecular formula C23H38N2O8 and a molecular weight of 470.56 g/mol. Its IUPAC name is (2S)-2-[[8-[[(1S)-1-carboxy-4-oxohexyl]amino]-8-oxooctanoyl]amino]-6-methyl-5-oxoheptanoic acid.
| Compound Name | (2S)-2-[[8-[[(1S)-1-carboxy-4-oxohexyl]amino]-8-oxooctanoyl]amino]-6-methyl-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 137425847 |
| Molecular Formula | C23H38N2O8 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (2S)-2-[[8-[[(1S)-1-carboxy-4-oxohexyl]amino]-8-oxooctanoyl]amino]-6-methyl-5-oxoheptanoic acid |
| SMILES | CCC(=O)CC[C@H](NC(=O)CCCCCCC(=O)N[C@@H](CCC(=O)C(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H38N2O8/c1-4-16(26)11-12-17(22(30)31)24-20(28)9-7-5-6-8-10-21(29)25-18(23(32)33)13-14-19(27)15(2)3/h15,17-18H,4-14H2,1-3H3,(H,24,28)(H,25,29)(H,30,31)(H,32,33)/t17-,18-/m0/s1 |
| InChIKey | ZFZXQPBTROGPMG-ROUUACIJSA-N |
| XLogP | 2.23 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|