C20H35NO8 — CID 87722888
4-[[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 87722888) has the molecular formula C20H35NO8 and a molecular weight of 417.50 g/mol. Its IUPAC name is 4-[[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
| Compound Name | 4-[[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87722888 |
| Molecular Formula | C20H35NO8 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 4-[[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)O)NC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO8/c1-18(2,3)27-15(24)12(10-11-13(22)23)21-14(16(25)28-19(4,5)6)17(26)29-20(7,8)9/h12,14,21H,10-11H2,1-9H3,(H,22,23) |
| InChIKey | FKRYMDDWVBZVOM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|