C14H23NO6 — CID 175996774
(4S)-4-(1,5-dioxopentan-2-ylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 175996774) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is (4S)-4-(1,5-dioxopentan-2-ylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
| Compound Name | (4S)-4-(1,5-dioxopentan-2-ylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175996774 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (4S)-4-(1,5-dioxopentan-2-ylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(C=O)CCC=O |
| InChI | InChI=1S/C14H23NO6/c1-14(2,3)21-13(20)11(6-7-12(18)19)15-10(9-17)5-4-8-16/h8-11,15H,4-7H2,1-3H3,(H,18,19)/t10?,11-/m0/s1 |
| InChIKey | SJLQKERJNQKYAZ-DTIOYNMSSA-N |
| XLogP | 0.70 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|