C18H32N2O6 — CID 166895013
tert-butyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-5-oxopentanoate (PubChem CID 166895013) has the molecular formula C18H32N2O6 and a molecular weight of 372.46 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 166895013 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | tert-butyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-5-oxopentanoate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](CCC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O6/c1-8-12(20-16(24)26-18(5,6)7)14(22)19-13(10-9-11-21)15(23)25-17(2,3)4/h11-13H,8-10H2,1-7H3,(H,19,22)(H,20,24)/t12-,13-/m1/s1 |
| InChIKey | MGAXBALAITZEBT-CHWSQXEVSA-N |
| XLogP | 2.10 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|