C20H44O3Si — CID 159916386
3-[di(propan-2-yl)-propoxysilyl]propyl 2,2,3-trimethylbutanoate;methane (PubChem CID 159916386) has the molecular formula C20H44O3Si and a molecular weight of 360.66 g/mol. Its IUPAC name is 3-[di(propan-2-yl)-propoxysilyl]propyl 2,2,3-trimethylbutanoate;methane.
| Compound Name | 3-[di(propan-2-yl)-propoxysilyl]propyl 2,2,3-trimethylbutanoate;methane |
|---|---|
| PubChem CID | 159916386 |
| Molecular Formula | C20H44O3Si |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 3-[di(propan-2-yl)-propoxysilyl]propyl 2,2,3-trimethylbutanoate;methane |
| SMILES | C.CCCO[Si](CCCOC(=O)C(C)(C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H40O3Si.CH4/c1-10-12-22-23(16(4)5,17(6)7)14-11-13-21-18(20)19(8,9)15(2)3;/h15-17H,10-14H2,1-9H3;1H4 |
| InChIKey | NXVIRUUJXDKNFF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|